C12H19ClN2O2S2 — CID 120706058
1-(2-methylsulfanylphenyl)sulfonylpiperidin-3-amine;hydrochloride (PubChem CID 120706058) has the molecular formula C12H19ClN2O2S2 and a molecular weight of 322.88 g/mol. Its IUPAC name is 1-(2-methylsulfanylphenyl)sulfonylpiperidin-3-amine;hydrochloride.
| Compound Name | 1-(2-methylsulfanylphenyl)sulfonylpiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120706058 |
| Molecular Formula | C12H19ClN2O2S2 |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 1-(2-methylsulfanylphenyl)sulfonylpiperidin-3-amine;hydrochloride |
| SMILES | CSc1ccccc1S(=O)(=O)N1CCCC(N)C1.Cl |
| InChI | InChI=1S/C12H18N2O2S2.ClH/c1-17-11-6-2-3-7-12(11)18(15,16)14-8-4-5-10(13)9-14;/h2-3,6-7,10H,4-5,8-9,13H2,1H3;1H |
| InChIKey | ZHFQJSLYGUKMRC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |