C14H20N2O2S2 — CID 120711799
3-(2-methylsulfanylphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 120711799) has the molecular formula C14H20N2O2S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is 3-(2-methylsulfanylphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 3-(2-methylsulfanylphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 120711799 |
| Molecular Formula | C14H20N2O2S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 3-(2-methylsulfanylphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | CSc1ccccc1S(=O)(=O)N1CCC2CCC(C1)N2 |
| InChI | InChI=1S/C14H20N2O2S2/c1-19-13-4-2-3-5-14(13)20(17,18)16-9-8-11-6-7-12(10-16)15-11/h2-5,11-12,15H,6-10H2,1H3 |
| InChIKey | ACPHWJQSEAMPPF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |