C17H26N2O2S — CID 119989478
3-(4-tert-butylphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 119989478) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 3-(4-tert-butylphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 119989478 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 3-(4-tert-butylphenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCC3CCC(C2)N3)cc1 |
| InChI | InChI=1S/C17H26N2O2S/c1-17(2,3)13-4-8-16(9-5-13)22(20,21)19-11-10-14-6-7-15(12-19)18-14/h4-5,8-9,14-15,18H,6-7,10-12H2,1-3H3 |
| InChIKey | FPDHPXQCPPLRDG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |