C18H27NO3S — CID 121197737
1-(4-tert-butylphenyl)sulfonyl-3-(cyclopropylmethoxy)pyrrolidine (PubChem CID 121197737) has the molecular formula C18H27NO3S and a molecular weight of 337.49 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)sulfonyl-3-(cyclopropylmethoxy)pyrrolidine.
| Compound Name | 1-(4-tert-butylphenyl)sulfonyl-3-(cyclopropylmethoxy)pyrrolidine |
|---|---|
| PubChem CID | 121197737 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1-(4-tert-butylphenyl)sulfonyl-3-(cyclopropylmethoxy)pyrrolidine |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCC(OCC3CC3)C2)cc1 |
| InChI | InChI=1S/C18H27NO3S/c1-18(2,3)15-6-8-17(9-7-15)23(20,21)19-11-10-16(12-19)22-13-14-4-5-14/h6-9,14,16H,4-5,10-13H2,1-3H3 |
| InChIKey | CBFLSVMOTIBITN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |