C16H22FNO4S — CID 121197743
3-(cyclopropylmethoxy)-1-(4-ethoxy-3-fluorophenyl)sulfonylpyrrolidine (PubChem CID 121197743) has the molecular formula C16H22FNO4S and a molecular weight of 343.42 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-1-(4-ethoxy-3-fluorophenyl)sulfonylpyrrolidine.
| Compound Name | 3-(cyclopropylmethoxy)-1-(4-ethoxy-3-fluorophenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 121197743 |
| Molecular Formula | C16H22FNO4S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 3-(cyclopropylmethoxy)-1-(4-ethoxy-3-fluorophenyl)sulfonylpyrrolidine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC(OCC3CC3)C2)cc1F |
| InChI | InChI=1S/C16H22FNO4S/c1-2-21-16-6-5-14(9-15(16)17)23(19,20)18-8-7-13(10-18)22-11-12-3-4-12/h5-6,9,12-13H,2-4,7-8,10-11H2,1H3 |
| InChIKey | JDWSRHCXOXMLNG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |