C17H22FN3O5S2 — CID 86265164
1-(4-ethoxy-3-fluorophenyl)sulfonyl-4-(1-methylimidazol-2-yl)sulfonylpiperidine (PubChem CID 86265164) has the molecular formula C17H22FN3O5S2 and a molecular weight of 431.51 g/mol. Its IUPAC name is 1-(4-ethoxy-3-fluorophenyl)sulfonyl-4-(1-methylimidazol-2-yl)sulfonylpiperidine.
| Compound Name | 1-(4-ethoxy-3-fluorophenyl)sulfonyl-4-(1-methylimidazol-2-yl)sulfonylpiperidine |
|---|---|
| PubChem CID | 86265164 |
| Molecular Formula | C17H22FN3O5S2 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 1-(4-ethoxy-3-fluorophenyl)sulfonyl-4-(1-methylimidazol-2-yl)sulfonylpiperidine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC(S(=O)(=O)c3nccn3C)CC2)cc1F |
| InChI | InChI=1S/C17H22FN3O5S2/c1-3-26-16-5-4-14(12-15(16)18)28(24,25)21-9-6-13(7-10-21)27(22,23)17-19-8-11-20(17)2/h4-5,8,11-13H,3,6-7,9-10H2,1-2H3 |
| InChIKey | BFOYBOWHHOMIAT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 98.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |