C14H19N3O4S3 — CID 86265156
4-(1-methylimidazol-2-yl)sulfonyl-1-(5-methylthiophen-2-yl)sulfonylpiperidine (PubChem CID 86265156) has the molecular formula C14H19N3O4S3 and a molecular weight of 389.52 g/mol. Its IUPAC name is 4-(1-methylimidazol-2-yl)sulfonyl-1-(5-methylthiophen-2-yl)sulfonylpiperidine.
| Compound Name | 4-(1-methylimidazol-2-yl)sulfonyl-1-(5-methylthiophen-2-yl)sulfonylpiperidine |
|---|---|
| PubChem CID | 86265156 |
| Molecular Formula | C14H19N3O4S3 |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 4-(1-methylimidazol-2-yl)sulfonyl-1-(5-methylthiophen-2-yl)sulfonylpiperidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(S(=O)(=O)c3nccn3C)CC2)s1 |
| InChI | InChI=1S/C14H19N3O4S3/c1-11-3-4-13(22-11)24(20,21)17-8-5-12(6-9-17)23(18,19)14-15-7-10-16(14)2/h3-4,7,10,12H,5-6,8-9H2,1-2H3 |
| InChIKey | ONBNXWRBXYJNKV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 89.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |