C14H18N2O4S2 — CID 113083144
1-[1-(5-methylthiophen-2-yl)sulfonylpiperidin-4-yl]pyrrolidine-2,5-dione (PubChem CID 113083144) has the molecular formula C14H18N2O4S2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[1-(5-methylthiophen-2-yl)sulfonylpiperidin-4-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[1-(5-methylthiophen-2-yl)sulfonylpiperidin-4-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 113083144 |
| Molecular Formula | C14H18N2O4S2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 1-[1-(5-methylthiophen-2-yl)sulfonylpiperidin-4-yl]pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(N3C(=O)CCC3=O)CC2)s1 |
| InChI | InChI=1S/C14H18N2O4S2/c1-10-2-5-14(21-10)22(19,20)15-8-6-11(7-9-15)16-12(17)3-4-13(16)18/h2,5,11H,3-4,6-9H2,1H3 |
| InChIKey | PHYLRBRWZQDLEK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|