C16H19NO4S3 — CID 90589444
4-(benzenesulfonyl)-1-(5-methylthiophen-2-yl)sulfonylpiperidine (PubChem CID 90589444) has the molecular formula C16H19NO4S3 and a molecular weight of 385.53 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-1-(5-methylthiophen-2-yl)sulfonylpiperidine.
| Compound Name | 4-(benzenesulfonyl)-1-(5-methylthiophen-2-yl)sulfonylpiperidine |
|---|---|
| PubChem CID | 90589444 |
| Molecular Formula | C16H19NO4S3 |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 4-(benzenesulfonyl)-1-(5-methylthiophen-2-yl)sulfonylpiperidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(S(=O)(=O)c3ccccc3)CC2)s1 |
| InChI | InChI=1S/C16H19NO4S3/c1-13-7-8-16(22-13)24(20,21)17-11-9-15(10-12-17)23(18,19)14-5-3-2-4-6-14/h2-8,15H,9-12H2,1H3 |
| InChIKey | RWEJUPHWAJLITK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |