C17H20FNO4S3 — CID 90589870
1-(5-ethylthiophen-2-yl)sulfonyl-4-(4-fluorophenyl)sulfonylpiperidine (PubChem CID 90589870) has the molecular formula C17H20FNO4S3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)sulfonyl-4-(4-fluorophenyl)sulfonylpiperidine.
| Compound Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-(4-fluorophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 90589870 |
| Molecular Formula | C17H20FNO4S3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-(4-fluorophenyl)sulfonylpiperidine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCC(S(=O)(=O)c3ccc(F)cc3)CC2)s1 |
| InChI | InChI=1S/C17H20FNO4S3/c1-2-14-5-8-17(24-14)26(22,23)19-11-9-16(10-12-19)25(20,21)15-6-3-13(18)4-7-15/h3-8,16H,2,9-12H2,1H3 |
| InChIKey | KLXQIXZYXNVAOX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |