C15H19NO2S3 — CID 90522198
1-(5-ethylthiophen-2-yl)sulfonyl-4-thiophen-2-ylpiperidine (PubChem CID 90522198) has the molecular formula C15H19NO2S3 and a molecular weight of 341.52 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)sulfonyl-4-thiophen-2-ylpiperidine.
| Compound Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-thiophen-2-ylpiperidine |
|---|---|
| PubChem CID | 90522198 |
| Molecular Formula | C15H19NO2S3 |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-thiophen-2-ylpiperidine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCC(c3cccs3)CC2)s1 |
| InChI | InChI=1S/C15H19NO2S3/c1-2-13-5-6-15(20-13)21(17,18)16-9-7-12(8-10-16)14-4-3-11-19-14/h3-6,11-12H,2,7-10H2,1H3 |
| InChIKey | FESXTJRPOQPZGN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |