C15H25NO4S3 — CID 90590289
1-(5-ethylthiophen-2-yl)sulfonyl-4-(2-methylpropylsulfonyl)piperidine (PubChem CID 90590289) has the molecular formula C15H25NO4S3 and a molecular weight of 379.57 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)sulfonyl-4-(2-methylpropylsulfonyl)piperidine.
| Compound Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-(2-methylpropylsulfonyl)piperidine |
|---|---|
| PubChem CID | 90590289 |
| Molecular Formula | C15H25NO4S3 |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)sulfonyl-4-(2-methylpropylsulfonyl)piperidine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCC(S(=O)(=O)CC(C)C)CC2)s1 |
| InChI | InChI=1S/C15H25NO4S3/c1-4-13-5-6-15(21-13)23(19,20)16-9-7-14(8-10-16)22(17,18)11-12(2)3/h5-6,12,14H,4,7-11H2,1-3H3 |
| InChIKey | RGJRDOGUGPPKBM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |