C15H24N2O6S3 — CID 90590371
4-[4-(2-methylpropylsulfonyl)piperidin-1-yl]sulfonylbenzenesulfonamide (PubChem CID 90590371) has the molecular formula C15H24N2O6S3 and a molecular weight of 424.57 g/mol. Its IUPAC name is 4-[4-(2-methylpropylsulfonyl)piperidin-1-yl]sulfonylbenzenesulfonamide.
| Compound Name | 4-[4-(2-methylpropylsulfonyl)piperidin-1-yl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 90590371 |
| Molecular Formula | C15H24N2O6S3 |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 4-[4-(2-methylpropylsulfonyl)piperidin-1-yl]sulfonylbenzenesulfonamide |
| SMILES | CC(C)CS(=O)(=O)C1CCN(S(=O)(=O)c2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C15H24N2O6S3/c1-12(2)11-24(18,19)13-7-9-17(10-8-13)26(22,23)15-5-3-14(4-6-15)25(16,20)21/h3-6,12-13H,7-11H2,1-2H3,(H2,16,20,21) |
| InChIKey | PIUYLSVPJWNTQB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |