C15H21F2NO4S2 — CID 90590341
1-(2,4-difluorophenyl)sulfonyl-4-(2-methylpropylsulfonyl)piperidine (PubChem CID 90590341) has the molecular formula C15H21F2NO4S2 and a molecular weight of 381.47 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)sulfonyl-4-(2-methylpropylsulfonyl)piperidine.
| Compound Name | 1-(2,4-difluorophenyl)sulfonyl-4-(2-methylpropylsulfonyl)piperidine |
|---|---|
| PubChem CID | 90590341 |
| Molecular Formula | C15H21F2NO4S2 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 1-(2,4-difluorophenyl)sulfonyl-4-(2-methylpropylsulfonyl)piperidine |
| SMILES | CC(C)CS(=O)(=O)C1CCN(S(=O)(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C15H21F2NO4S2/c1-11(2)10-23(19,20)13-5-7-18(8-6-13)24(21,22)15-4-3-12(16)9-14(15)17/h3-4,9,11,13H,5-8,10H2,1-2H3 |
| InChIKey | YMTYSSRYADACCQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |