C17H27NO4S2 — CID 90590279
1-(2,4-dimethylphenyl)sulfonyl-4-(2-methylpropylsulfonyl)piperidine (PubChem CID 90590279) has the molecular formula C17H27NO4S2 and a molecular weight of 373.54 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)sulfonyl-4-(2-methylpropylsulfonyl)piperidine.
| Compound Name | 1-(2,4-dimethylphenyl)sulfonyl-4-(2-methylpropylsulfonyl)piperidine |
|---|---|
| PubChem CID | 90590279 |
| Molecular Formula | C17H27NO4S2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-(2,4-dimethylphenyl)sulfonyl-4-(2-methylpropylsulfonyl)piperidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(S(=O)(=O)CC(C)C)CC2)c(C)c1 |
| InChI | InChI=1S/C17H27NO4S2/c1-13(2)12-23(19,20)16-7-9-18(10-8-16)24(21,22)17-6-5-14(3)11-15(17)4/h5-6,11,13,16H,7-10,12H2,1-4H3 |
| InChIKey | DHUOZPKZRIKCIQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |