C17H26N2O5S2 — CID 90592831
N-methyl-2-[1-(4-propan-2-ylphenyl)sulfonylpiperidin-4-yl]sulfonylacetamide (PubChem CID 90592831) has the molecular formula C17H26N2O5S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is N-methyl-2-[1-(4-propan-2-ylphenyl)sulfonylpiperidin-4-yl]sulfonylacetamide.
| Compound Name | N-methyl-2-[1-(4-propan-2-ylphenyl)sulfonylpiperidin-4-yl]sulfonylacetamide |
|---|---|
| PubChem CID | 90592831 |
| Molecular Formula | C17H26N2O5S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-methyl-2-[1-(4-propan-2-ylphenyl)sulfonylpiperidin-4-yl]sulfonylacetamide |
| SMILES | CNC(=O)CS(=O)(=O)C1CCN(S(=O)(=O)c2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C17H26N2O5S2/c1-13(2)14-4-6-16(7-5-14)26(23,24)19-10-8-15(9-11-19)25(21,22)12-17(20)18-3/h4-7,13,15H,8-12H2,1-3H3,(H,18,20) |
| InChIKey | JOOYJTBUZDYXKI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |