C21H26N2O6S2 — CID 90592877
N-methyl-2-[1-[4-(2-methylphenoxy)phenyl]sulfonylpiperidin-4-yl]sulfonylacetamide (PubChem CID 90592877) has the molecular formula C21H26N2O6S2 and a molecular weight of 466.58 g/mol. Its IUPAC name is N-methyl-2-[1-[4-(2-methylphenoxy)phenyl]sulfonylpiperidin-4-yl]sulfonylacetamide.
| Compound Name | N-methyl-2-[1-[4-(2-methylphenoxy)phenyl]sulfonylpiperidin-4-yl]sulfonylacetamide |
|---|---|
| PubChem CID | 90592877 |
| Molecular Formula | C21H26N2O6S2 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | N-methyl-2-[1-[4-(2-methylphenoxy)phenyl]sulfonylpiperidin-4-yl]sulfonylacetamide |
| SMILES | CNC(=O)CS(=O)(=O)C1CCN(S(=O)(=O)c2ccc(Oc3ccccc3C)cc2)CC1 |
| InChI | InChI=1S/C21H26N2O6S2/c1-16-5-3-4-6-20(16)29-17-7-9-19(10-8-17)31(27,28)23-13-11-18(12-14-23)30(25,26)15-21(24)22-2/h3-10,18H,11-15H2,1-2H3,(H,22,24) |
| InChIKey | DONKQOQTMISYIW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |