C20H20N2O4S2 — CID 121150751
2-[1-[4-(2-methylphenoxy)phenyl]sulfonylpyrrolidin-3-yl]oxy-1,3-thiazole (PubChem CID 121150751) has the molecular formula C20H20N2O4S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[1-[4-(2-methylphenoxy)phenyl]sulfonylpyrrolidin-3-yl]oxy-1,3-thiazole.
| Compound Name | 2-[1-[4-(2-methylphenoxy)phenyl]sulfonylpyrrolidin-3-yl]oxy-1,3-thiazole |
|---|---|
| PubChem CID | 121150751 |
| Molecular Formula | C20H20N2O4S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 2-[1-[4-(2-methylphenoxy)phenyl]sulfonylpyrrolidin-3-yl]oxy-1,3-thiazole |
| SMILES | Cc1ccccc1Oc1ccc(S(=O)(=O)N2CCC(Oc3nccs3)C2)cc1 |
| InChI | InChI=1S/C20H20N2O4S2/c1-15-4-2-3-5-19(15)25-16-6-8-18(9-7-16)28(23,24)22-12-10-17(14-22)26-20-21-11-13-27-20/h2-9,11,13,17H,10,12,14H2,1H3 |
| InChIKey | UZNJCLXEXAAQPO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |