C12H11ClN2O3S2 — CID 90627754
2-[1-(4-chlorophenyl)sulfonylazetidin-3-yl]oxy-1,3-thiazole (PubChem CID 90627754) has the molecular formula C12H11ClN2O3S2 and a molecular weight of 330.82 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)sulfonylazetidin-3-yl]oxy-1,3-thiazole.
| Compound Name | 2-[1-(4-chlorophenyl)sulfonylazetidin-3-yl]oxy-1,3-thiazole |
|---|---|
| PubChem CID | 90627754 |
| Molecular Formula | C12H11ClN2O3S2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 2-[1-(4-chlorophenyl)sulfonylazetidin-3-yl]oxy-1,3-thiazole |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CC(Oc2nccs2)C1 |
| InChI | InChI=1S/C12H11ClN2O3S2/c13-9-1-3-11(4-2-9)20(16,17)15-7-10(8-15)18-12-14-5-6-19-12/h1-6,10H,7-8H2 |
| InChIKey | XPGWBIFSZVJTEY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |