C13H12Cl2N2O3S2 — CID 121150752
2-[1-(2,6-dichlorophenyl)sulfonylpyrrolidin-3-yl]oxy-1,3-thiazole (PubChem CID 121150752) has the molecular formula C13H12Cl2N2O3S2 and a molecular weight of 379.29 g/mol. Its IUPAC name is 2-[1-(2,6-dichlorophenyl)sulfonylpyrrolidin-3-yl]oxy-1,3-thiazole.
| Compound Name | 2-[1-(2,6-dichlorophenyl)sulfonylpyrrolidin-3-yl]oxy-1,3-thiazole |
|---|---|
| PubChem CID | 121150752 |
| Molecular Formula | C13H12Cl2N2O3S2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 2-[1-(2,6-dichlorophenyl)sulfonylpyrrolidin-3-yl]oxy-1,3-thiazole |
| SMILES | O=S(=O)(c1c(Cl)cccc1Cl)N1CCC(Oc2nccs2)C1 |
| InChI | InChI=1S/C13H12Cl2N2O3S2/c14-10-2-1-3-11(15)12(10)22(18,19)17-6-4-9(8-17)20-13-16-5-7-21-13/h1-3,5,7,9H,4,6,8H2 |
| InChIKey | AHMANLGPDABDEN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |