C16H14N2O3S2 — CID 90627732
2-(1-naphthalen-1-ylsulfonylazetidin-3-yl)oxy-1,3-thiazole (PubChem CID 90627732) has the molecular formula C16H14N2O3S2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-(1-naphthalen-1-ylsulfonylazetidin-3-yl)oxy-1,3-thiazole.
| Compound Name | 2-(1-naphthalen-1-ylsulfonylazetidin-3-yl)oxy-1,3-thiazole |
|---|---|
| PubChem CID | 90627732 |
| Molecular Formula | C16H14N2O3S2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 2-(1-naphthalen-1-ylsulfonylazetidin-3-yl)oxy-1,3-thiazole |
| SMILES | O=S(=O)(c1cccc2ccccc12)N1CC(Oc2nccs2)C1 |
| InChI | InChI=1S/C16H14N2O3S2/c19-23(20,15-7-3-5-12-4-1-2-6-14(12)15)18-10-13(11-18)21-16-17-8-9-22-16/h1-9,13H,10-11H2 |
| InChIKey | WLFWYJHZXMQFPE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |