C10H12Cl2N2O2S — CID 94340426
(3S)-1-(2,6-dichlorophenyl)sulfonylpyrrolidin-3-amine (PubChem CID 94340426) has the molecular formula C10H12Cl2N2O2S and a molecular weight of 295.19 g/mol. Its IUPAC name is (3S)-1-(2,6-dichlorophenyl)sulfonylpyrrolidin-3-amine.
| Compound Name | (3S)-1-(2,6-dichlorophenyl)sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 94340426 |
| Molecular Formula | C10H12Cl2N2O2S |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | (3S)-1-(2,6-dichlorophenyl)sulfonylpyrrolidin-3-amine |
| SMILES | N[C@H]1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C10H12Cl2N2O2S/c11-8-2-1-3-9(12)10(8)17(15,16)14-5-4-7(13)6-14/h1-3,7H,4-6,13H2/t7-/m0/s1 |
| InChIKey | CFIHXTPQOWCQIP-ZETCQYMHSA-N |
| XLogP | 1.72 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |