C10H11Cl3N2O2S — CID 115301799
(3R)-1-(2,4,6-trichlorophenyl)sulfonylpyrrolidin-3-amine (PubChem CID 115301799) has the molecular formula C10H11Cl3N2O2S and a molecular weight of 329.64 g/mol. Its IUPAC name is (3R)-1-(2,4,6-trichlorophenyl)sulfonylpyrrolidin-3-amine.
| Compound Name | (3R)-1-(2,4,6-trichlorophenyl)sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 115301799 |
| Molecular Formula | C10H11Cl3N2O2S |
| Molecular Weight | 329.64 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | (3R)-1-(2,4,6-trichlorophenyl)sulfonylpyrrolidin-3-amine |
| SMILES | N[C@@H]1CCN(S(=O)(=O)c2c(Cl)cc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C10H11Cl3N2O2S/c11-6-3-8(12)10(9(13)4-6)18(16,17)15-2-1-7(14)5-15/h3-4,7H,1-2,5,14H2/t7-/m1/s1 |
| InChIKey | IZAKMUZLRGEVHZ-SSDOTTSWSA-N |
| XLogP | 2.37 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.64 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |