C13H15Cl3N2O2S — CID 115314141
3-(2,4,6-trichlorophenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 115314141) has the molecular formula C13H15Cl3N2O2S and a molecular weight of 369.70 g/mol. Its IUPAC name is 3-(2,4,6-trichlorophenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 3-(2,4,6-trichlorophenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 115314141 |
| Molecular Formula | C13H15Cl3N2O2S |
| Molecular Weight | 369.70 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 3-(2,4,6-trichlorophenyl)sulfonyl-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | O=S(=O)(c1c(Cl)cc(Cl)cc1Cl)N1CCC2CCC(C1)N2 |
| InChI | InChI=1S/C13H15Cl3N2O2S/c14-8-5-11(15)13(12(16)6-8)21(19,20)18-4-3-9-1-2-10(7-18)17-9/h5-6,9-10,17H,1-4,7H2 |
| InChIKey | MFFNJOREALGZHG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.70 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |