C12H13Cl3N2O2S — CID 66211046
5-(2,4,6-trichlorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 66211046) has the molecular formula C12H13Cl3N2O2S and a molecular weight of 355.67 g/mol. Its IUPAC name is 5-(2,4,6-trichlorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(2,4,6-trichlorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66211046 |
| Molecular Formula | C12H13Cl3N2O2S |
| Molecular Weight | 355.67 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 5-(2,4,6-trichlorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | O=S(=O)(c1c(Cl)cc(Cl)cc1Cl)N1CC2CNCC2C1 |
| InChI | InChI=1S/C12H13Cl3N2O2S/c13-9-1-10(14)12(11(15)2-9)20(18,19)17-5-7-3-16-4-8(7)6-17/h1-2,7-8,16H,3-6H2 |
| InChIKey | LKWGXCFHTRFJDL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.67 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |