C13H17Cl2FN2O2S — CID 120665189
(3aS,6aR)-5-(2-chloro-4-fluoro-5-methylphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 120665189) has the molecular formula C13H17Cl2FN2O2S and a molecular weight of 355.26 g/mol. Its IUPAC name is (3aS,6aR)-5-(2-chloro-4-fluoro-5-methylphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3aS,6aR)-5-(2-chloro-4-fluoro-5-methylphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 120665189 |
| Molecular Formula | C13H17Cl2FN2O2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | (3aS,6aR)-5-(2-chloro-4-fluoro-5-methylphenyl)sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | Cc1cc(S(=O)(=O)N2C[C@H]3CNC[C@H]3C2)c(Cl)cc1F.Cl |
| InChI | InChI=1S/C13H16ClFN2O2S.ClH/c1-8-2-13(11(14)3-12(8)15)20(18,19)17-6-9-4-16-5-10(9)7-17;/h2-3,9-10,16H,4-7H2,1H3;1H/t9-,10+; |
| InChIKey | MYDIQEPCFGJDBG-JMVWIVNTSA-N |
| XLogP | 2.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |