C14H18Cl2FN3O3S — CID 120665641
N-[4-[[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]-2-chloro-5-fluorophenyl]acetamide;hydrochloride (PubChem CID 120665641) has the molecular formula C14H18Cl2FN3O3S and a molecular weight of 398.29 g/mol. Its IUPAC name is N-[4-[[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]-2-chloro-5-fluorophenyl]acetamide;hydrochloride.
| Compound Name | N-[4-[[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]-2-chloro-5-fluorophenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 120665641 |
| Molecular Formula | C14H18Cl2FN3O3S |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | N-[4-[[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]-2-chloro-5-fluorophenyl]acetamide;hydrochloride |
| SMILES | CC(=O)Nc1cc(F)c(S(=O)(=O)N2C[C@H]3CNC[C@H]3C2)cc1Cl.Cl |
| InChI | InChI=1S/C14H17ClFN3O3S.ClH/c1-8(20)18-13-3-12(16)14(2-11(13)15)23(21,22)19-6-9-4-17-5-10(9)7-19;/h2-3,9-10,17H,4-7H2,1H3,(H,18,20);1H/t9-,10+; |
| InChIKey | BTEJWZDGJPFQIA-JMVWIVNTSA-N |
| XLogP | 1.70 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |