C14H19ClFN3O3S — CID 120726547
N-[2-chloro-5-fluoro-4-[(2-methylpiperidin-3-yl)sulfamoyl]phenyl]acetamide (PubChem CID 120726547) has the molecular formula C14H19ClFN3O3S and a molecular weight of 363.84 g/mol. Its IUPAC name is N-[2-chloro-5-fluoro-4-[(2-methylpiperidin-3-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[2-chloro-5-fluoro-4-[(2-methylpiperidin-3-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 120726547 |
| Molecular Formula | C14H19ClFN3O3S |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | N-[2-chloro-5-fluoro-4-[(2-methylpiperidin-3-yl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(F)c(S(=O)(=O)NC2CCCNC2C)cc1Cl |
| InChI | InChI=1S/C14H19ClFN3O3S/c1-8-12(4-3-5-17-8)19-23(21,22)14-6-10(15)13(7-11(14)16)18-9(2)20/h6-8,12,17,19H,3-5H2,1-2H3,(H,18,20) |
| InChIKey | QEDFBIPYIYWPTQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |