C14H20ClN3O4S — CID 120726795
2-[4-chloro-2-[(2-methylpiperidin-3-yl)sulfamoyl]phenoxy]acetamide (PubChem CID 120726795) has the molecular formula C14H20ClN3O4S and a molecular weight of 361.85 g/mol. Its IUPAC name is 2-[4-chloro-2-[(2-methylpiperidin-3-yl)sulfamoyl]phenoxy]acetamide.
| Compound Name | 2-[4-chloro-2-[(2-methylpiperidin-3-yl)sulfamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 120726795 |
| Molecular Formula | C14H20ClN3O4S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-[4-chloro-2-[(2-methylpiperidin-3-yl)sulfamoyl]phenoxy]acetamide |
| SMILES | CC1NCCCC1NS(=O)(=O)c1cc(Cl)ccc1OCC(N)=O |
| InChI | InChI=1S/C14H20ClN3O4S/c1-9-11(3-2-6-17-9)18-23(20,21)13-7-10(15)4-5-12(13)22-8-14(16)19/h4-5,7,9,11,17-18H,2-3,6,8H2,1H3,(H2,16,19) |
| InChIKey | PIUKBOYGIYXFAI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |