C15H23ClN2O4S — CID 120726210
methyl 5-methyl-2-[(2-methylpiperidin-3-yl)sulfamoyl]benzoate;hydrochloride (PubChem CID 120726210) has the molecular formula C15H23ClN2O4S and a molecular weight of 362.88 g/mol. Its IUPAC name is methyl 5-methyl-2-[(2-methylpiperidin-3-yl)sulfamoyl]benzoate;hydrochloride.
| Compound Name | methyl 5-methyl-2-[(2-methylpiperidin-3-yl)sulfamoyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 120726210 |
| Molecular Formula | C15H23ClN2O4S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | methyl 5-methyl-2-[(2-methylpiperidin-3-yl)sulfamoyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1cc(C)ccc1S(=O)(=O)NC1CCCNC1C.Cl |
| InChI | InChI=1S/C15H22N2O4S.ClH/c1-10-6-7-14(12(9-10)15(18)21-3)22(19,20)17-13-5-4-8-16-11(13)2;/h6-7,9,11,13,16-17H,4-5,8H2,1-3H3;1H |
| InChIKey | ZLHNZSWQBRGWNR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |