C14H22N2O2S — CID 124515702
2,4-dimethyl-N-[(2R,3R)-2-methylpiperidin-3-yl]benzenesulfonamide (PubChem CID 124515702) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(2R,3R)-2-methylpiperidin-3-yl]benzenesulfonamide.
| Compound Name | 2,4-dimethyl-N-[(2R,3R)-2-methylpiperidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 124515702 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2,4-dimethyl-N-[(2R,3R)-2-methylpiperidin-3-yl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2CCCN[C@@H]2C)c(C)c1 |
| InChI | InChI=1S/C14H22N2O2S/c1-10-6-7-14(11(2)9-10)19(17,18)16-13-5-4-8-15-12(13)3/h6-7,9,12-13,15-16H,4-5,8H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | KYZNYRGCPAPKPY-CHWSQXEVSA-N |
| XLogP | 1.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |