C14H21NO3S — CID 103835923
N-[2-(hydroxymethyl)cyclopentyl]-2,4-dimethylbenzenesulfonamide (PubChem CID 103835923) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is N-[2-(hydroxymethyl)cyclopentyl]-2,4-dimethylbenzenesulfonamide.
| Compound Name | N-[2-(hydroxymethyl)cyclopentyl]-2,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 103835923 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-[2-(hydroxymethyl)cyclopentyl]-2,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCCC2CO)c(C)c1 |
| InChI | InChI=1S/C14H21NO3S/c1-10-6-7-14(11(2)8-10)19(17,18)15-13-5-3-4-12(13)9-16/h6-8,12-13,15-16H,3-5,9H2,1-2H3 |
| InChIKey | NKMYYPCVHOTRJX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |