C15H22N2O4S — CID 120725425
methyl 2-(2,3-dimethylpiperazin-1-yl)sulfonyl-5-methylbenzoate (PubChem CID 120725425) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is methyl 2-(2,3-dimethylpiperazin-1-yl)sulfonyl-5-methylbenzoate.
| Compound Name | methyl 2-(2,3-dimethylpiperazin-1-yl)sulfonyl-5-methylbenzoate |
|---|---|
| PubChem CID | 120725425 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | methyl 2-(2,3-dimethylpiperazin-1-yl)sulfonyl-5-methylbenzoate |
| SMILES | COC(=O)c1cc(C)ccc1S(=O)(=O)N1CCNC(C)C1C |
| InChI | InChI=1S/C15H22N2O4S/c1-10-5-6-14(13(9-10)15(18)21-4)22(19,20)17-8-7-16-11(2)12(17)3/h5-6,9,11-12,16H,7-8H2,1-4H3 |
| InChIKey | CINYZAZSBOKEGV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |