C13H20ClN3O4S — CID 120716467
2-[4-chloro-2-[2-(propylamino)ethylsulfamoyl]phenoxy]acetamide (PubChem CID 120716467) has the molecular formula C13H20ClN3O4S and a molecular weight of 349.84 g/mol. Its IUPAC name is 2-[4-chloro-2-[2-(propylamino)ethylsulfamoyl]phenoxy]acetamide.
| Compound Name | 2-[4-chloro-2-[2-(propylamino)ethylsulfamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 120716467 |
| Molecular Formula | C13H20ClN3O4S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-[4-chloro-2-[2-(propylamino)ethylsulfamoyl]phenoxy]acetamide |
| SMILES | CCCNCCNS(=O)(=O)c1cc(Cl)ccc1OCC(N)=O |
| InChI | InChI=1S/C13H20ClN3O4S/c1-2-5-16-6-7-17-22(19,20)12-8-10(14)3-4-11(12)21-9-13(15)18/h3-4,8,16-17H,2,5-7,9H2,1H3,(H2,15,18) |
| InChIKey | MQRLRYSTGJMMEZ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|