C13H22Cl3N3O3 — CID 17054063
2-[4-chloro-2-[[2-(2-hydroxyethylamino)ethylamino]methyl]phenoxy]acetamide;dihydrochloride (PubChem CID 17054063) has the molecular formula C13H22Cl3N3O3 and a molecular weight of 374.70 g/mol. Its IUPAC name is 2-[4-chloro-2-[[2-(2-hydroxyethylamino)ethylamino]methyl]phenoxy]acetamide;dihydrochloride.
| Compound Name | 2-[4-chloro-2-[[2-(2-hydroxyethylamino)ethylamino]methyl]phenoxy]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 17054063 |
| Molecular Formula | C13H22Cl3N3O3 |
| Molecular Weight | 374.70 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-[4-chloro-2-[[2-(2-hydroxyethylamino)ethylamino]methyl]phenoxy]acetamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)COc1ccc(Cl)cc1CNCCNCCO |
| InChI | InChI=1S/C13H20ClN3O3.2ClH/c14-11-1-2-12(20-9-13(15)19)10(7-11)8-17-4-3-16-5-6-18;;/h1-2,7,16-18H,3-6,8-9H2,(H2,15,19);2*1H |
| InChIKey | XIGPJXIFWSGIJJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.70 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|