C10H12ClF2NO2 — CID 43424974
2-[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]ethanol (PubChem CID 43424974) has the molecular formula C10H12ClF2NO2 and a molecular weight of 251.66 g/mol. Its IUPAC name is 2-[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]ethanol.
| Compound Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 43424974 |
| Molecular Formula | C10H12ClF2NO2 |
| Molecular Weight | 251.66 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]ethanol |
| SMILES | OCCNCc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C10H12ClF2NO2/c11-8-1-2-9(16-10(12)13)7(5-8)6-14-3-4-15/h1-2,5,10,14-15H,3-4,6H2 |
| InChIKey | KPVAZDYTBVAJQY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.66 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|