C14H21ClF2N2O — CID 43425082
N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 43425082) has the molecular formula C14H21ClF2N2O and a molecular weight of 306.78 g/mol. Its IUPAC name is N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 43425082 |
| Molecular Formula | C14H21ClF2N2O |
| Molecular Weight | 306.78 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C14H21ClF2N2O/c1-3-19(4-2)8-7-18-10-11-9-12(15)5-6-13(11)20-14(16)17/h5-6,9,14,18H,3-4,7-8,10H2,1-2H3 |
| InChIKey | OLQVSOFGZRKZBN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.78 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|