C13H18ClF2NO2 — CID 107302833
5-[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]pentan-1-ol (PubChem CID 107302833) has the molecular formula C13H18ClF2NO2 and a molecular weight of 293.74 g/mol. Its IUPAC name is 5-[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]pentan-1-ol.
| Compound Name | 5-[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 107302833 |
| Molecular Formula | C13H18ClF2NO2 |
| Molecular Weight | 293.74 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 5-[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]pentan-1-ol |
| SMILES | OCCCCCNCc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C13H18ClF2NO2/c14-11-4-5-12(19-13(15)16)10(8-11)9-17-6-2-1-3-7-18/h4-5,8,13,17-18H,1-3,6-7,9H2 |
| InChIKey | MOQCBWOJEONYIO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.74 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|