C14H14ClF2NOS — CID 43425059
N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-thiophen-2-ylethanamine (PubChem CID 43425059) has the molecular formula C14H14ClF2NOS and a molecular weight of 317.79 g/mol. Its IUPAC name is N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-thiophen-2-ylethanamine.
| Compound Name | N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 43425059 |
| Molecular Formula | C14H14ClF2NOS |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-2-thiophen-2-ylethanamine |
| SMILES | FC(F)Oc1ccc(Cl)cc1CNCCc1cccs1 |
| InChI | InChI=1S/C14H14ClF2NOS/c15-11-3-4-13(19-14(16)17)10(8-11)9-18-6-5-12-2-1-7-20-12/h1-4,7-8,14,18H,5-6,9H2 |
| InChIKey | JADFEBXEZHGJLW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|