C15H16ClF2N3OS — CID 111758113
2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111758113) has the molecular formula C15H16ClF2N3OS and a molecular weight of 359.83 g/mol. Its IUPAC name is 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111758113 |
| Molecular Formula | C15H16ClF2N3OS |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine |
| SMILES | N/C(=N\Cc1cc(Cl)ccc1OC(F)F)NCCc1cccs1 |
| InChI | InChI=1S/C15H16ClF2N3OS/c16-11-3-4-13(22-14(17)18)10(8-11)9-21-15(19)20-6-5-12-2-1-7-23-12/h1-4,7-8,14H,5-6,9H2,(H3,19,20,21) |
| InChIKey | CCABKYGQGBTPFL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|