C17H20F3N3O2S — CID 111048186
2-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111048186) has the molecular formula C17H20F3N3O2S and a molecular weight of 387.43 g/mol. Its IUPAC name is 2-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111048186 |
| Molecular Formula | C17H20F3N3O2S |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 2-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-1-(2-thiophen-2-ylethyl)guanidine |
| SMILES | COc1cc(C/N=C(\N)NCCc2cccs2)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C17H20F3N3O2S/c1-24-15-9-12(4-5-14(15)25-11-17(18,19)20)10-23-16(21)22-7-6-13-3-2-8-26-13/h2-5,8-9H,6-7,10-11H2,1H3,(H3,21,22,23) |
| InChIKey | YXJMIPXFZVLVEP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|