C15H22F3N3O2 — CID 111048172
2-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-1-(2-methylpropyl)guanidine (PubChem CID 111048172) has the molecular formula C15H22F3N3O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is 2-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-1-(2-methylpropyl)guanidine.
| Compound Name | 2-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-1-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 111048172 |
| Molecular Formula | C15H22F3N3O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-1-(2-methylpropyl)guanidine |
| SMILES | COc1cc(C/N=C(\N)NCC(C)C)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C15H22F3N3O2/c1-10(2)7-20-14(19)21-8-11-4-5-12(13(6-11)22-3)23-9-15(16,17)18/h4-6,10H,7-9H2,1-3H3,(H3,19,20,21) |
| InChIKey | VNPWMHXCFXNIJE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|