C9H10ClF2NO — CID 43214102
1-[5-chloro-2-(difluoromethoxy)phenyl]-N-methylmethanamine (PubChem CID 43214102) has the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. Its IUPAC name is 1-[5-chloro-2-(difluoromethoxy)phenyl]-N-methylmethanamine.
| Compound Name | 1-[5-chloro-2-(difluoromethoxy)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 43214102 |
| Molecular Formula | C9H10ClF2NO |
| Molecular Weight | 221.63 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 1-[5-chloro-2-(difluoromethoxy)phenyl]-N-methylmethanamine |
| SMILES | CNCc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C9H10ClF2NO/c1-13-5-6-4-7(10)2-3-8(6)14-9(11)12/h2-4,9,13H,5H2,1H3 |
| InChIKey | NRPPDNKLIQJWEI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.63 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |