C12H16ClF2NO2 — CID 82719785
1-[5-chloro-2-(difluoromethoxy)phenyl]-N-[(2-methylpropan-2-yl)oxy]methanamine (PubChem CID 82719785) has the molecular formula C12H16ClF2NO2 and a molecular weight of 279.71 g/mol. Its IUPAC name is 1-[5-chloro-2-(difluoromethoxy)phenyl]-N-[(2-methylpropan-2-yl)oxy]methanamine.
| Compound Name | 1-[5-chloro-2-(difluoromethoxy)phenyl]-N-[(2-methylpropan-2-yl)oxy]methanamine |
|---|---|
| PubChem CID | 82719785 |
| Molecular Formula | C12H16ClF2NO2 |
| Molecular Weight | 279.71 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 1-[5-chloro-2-(difluoromethoxy)phenyl]-N-[(2-methylpropan-2-yl)oxy]methanamine |
| SMILES | CC(C)(C)ONCc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C12H16ClF2NO2/c1-12(2,3)18-16-7-8-6-9(13)4-5-10(8)17-11(14)15/h4-6,11,16H,7H2,1-3H3 |
| InChIKey | WNXPACDVIHQIAK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.71 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|