C14H18ClF2NO3 — CID 43619420
2-[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]-2-methylpentanoic acid (PubChem CID 43619420) has the molecular formula C14H18ClF2NO3 and a molecular weight of 321.75 g/mol. Its IUPAC name is 2-[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]-2-methylpentanoic acid.
| Compound Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 43619420 |
| Molecular Formula | C14H18ClF2NO3 |
| Molecular Weight | 321.75 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-[[5-chloro-2-(difluoromethoxy)phenyl]methylamino]-2-methylpentanoic acid |
| SMILES | CCCC(C)(NCc1cc(Cl)ccc1OC(F)F)C(=O)O |
| InChI | InChI=1S/C14H18ClF2NO3/c1-3-6-14(2,12(19)20)18-8-9-7-10(15)4-5-11(9)21-13(16)17/h4-5,7,13,18H,3,6,8H2,1-2H3,(H,19,20) |
| InChIKey | QTMKQBHEZQNKOX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.75 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |