C12H13ClF2O3S — CID 64916884
3-[[5-chloro-2-(difluoromethoxy)phenyl]methylsulfanyl]-2-methylpropanoic acid (PubChem CID 64916884) has the molecular formula C12H13ClF2O3S and a molecular weight of 310.75 g/mol. Its IUPAC name is 3-[[5-chloro-2-(difluoromethoxy)phenyl]methylsulfanyl]-2-methylpropanoic acid.
| Compound Name | 3-[[5-chloro-2-(difluoromethoxy)phenyl]methylsulfanyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 64916884 |
| Molecular Formula | C12H13ClF2O3S |
| Molecular Weight | 310.75 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 3-[[5-chloro-2-(difluoromethoxy)phenyl]methylsulfanyl]-2-methylpropanoic acid |
| SMILES | CC(CSCc1cc(Cl)ccc1OC(F)F)C(=O)O |
| InChI | InChI=1S/C12H13ClF2O3S/c1-7(11(16)17)5-19-6-8-4-9(13)2-3-10(8)18-12(14)15/h2-4,7,12H,5-6H2,1H3,(H,16,17) |
| InChIKey | JJKRCKFECOOAJB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.75 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |