C13H16ClF2NO3 — CID 61009362
3-[[5-chloro-2-(difluoromethoxy)phenyl]methyl-ethylamino]propanoic acid (PubChem CID 61009362) has the molecular formula C13H16ClF2NO3 and a molecular weight of 307.72 g/mol. Its IUPAC name is 3-[[5-chloro-2-(difluoromethoxy)phenyl]methyl-ethylamino]propanoic acid.
| Compound Name | 3-[[5-chloro-2-(difluoromethoxy)phenyl]methyl-ethylamino]propanoic acid |
|---|---|
| PubChem CID | 61009362 |
| Molecular Formula | C13H16ClF2NO3 |
| Molecular Weight | 307.72 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3-[[5-chloro-2-(difluoromethoxy)phenyl]methyl-ethylamino]propanoic acid |
| SMILES | CCN(CCC(=O)O)Cc1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C13H16ClF2NO3/c1-2-17(6-5-12(18)19)8-9-7-10(14)3-4-11(9)20-13(15)16/h3-4,7,13H,2,5-6,8H2,1H3,(H,18,19) |
| InChIKey | OROIESUACKTAJJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.72 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |