C13H17F2NO3 — CID 61011180
3-[[2-(difluoromethoxy)phenyl]methyl-ethylamino]propanoic acid (PubChem CID 61011180) has the molecular formula C13H17F2NO3 and a molecular weight of 273.28 g/mol. Its IUPAC name is 3-[[2-(difluoromethoxy)phenyl]methyl-ethylamino]propanoic acid.
| Compound Name | 3-[[2-(difluoromethoxy)phenyl]methyl-ethylamino]propanoic acid |
|---|---|
| PubChem CID | 61011180 |
| Molecular Formula | C13H17F2NO3 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 3-[[2-(difluoromethoxy)phenyl]methyl-ethylamino]propanoic acid |
| SMILES | CCN(CCC(=O)O)Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C13H17F2NO3/c1-2-16(8-7-12(17)18)9-10-5-3-4-6-11(10)19-13(14)15/h3-6,13H,2,7-9H2,1H3,(H,17,18) |
| InChIKey | YWZCLSSJJWOTQM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |