C12H14F2N2O4 — CID 107440320
2-[(2-amino-2-oxoethyl)-[[2-(difluoromethoxy)phenyl]methyl]amino]acetic acid (PubChem CID 107440320) has the molecular formula C12H14F2N2O4 and a molecular weight of 288.25 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[[2-(difluoromethoxy)phenyl]methyl]amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[[2-(difluoromethoxy)phenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 107440320 |
| Molecular Formula | C12H14F2N2O4 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[[2-(difluoromethoxy)phenyl]methyl]amino]acetic acid |
| SMILES | NC(=O)CN(CC(=O)O)Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C12H14F2N2O4/c13-12(14)20-9-4-2-1-3-8(9)5-16(6-10(15)17)7-11(18)19/h1-4,12H,5-7H2,(H2,15,17)(H,18,19) |
| InChIKey | UEAGKCRJDHQHBK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |