C11H15F2N3O — CID 54939184
2-[(2-aminophenyl)methyl-(2,2-difluoroethyl)amino]acetamide (PubChem CID 54939184) has the molecular formula C11H15F2N3O and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-[(2-aminophenyl)methyl-(2,2-difluoroethyl)amino]acetamide.
| Compound Name | 2-[(2-aminophenyl)methyl-(2,2-difluoroethyl)amino]acetamide |
|---|---|
| PubChem CID | 54939184 |
| Molecular Formula | C11H15F2N3O |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 2-[(2-aminophenyl)methyl-(2,2-difluoroethyl)amino]acetamide |
| SMILES | NC(=O)CN(Cc1ccccc1N)CC(F)F |
| InChI | InChI=1S/C11H15F2N3O/c12-10(13)6-16(7-11(15)17)5-8-3-1-2-4-9(8)14/h1-4,10H,5-7,14H2,(H2,15,17) |
| InChIKey | CUJPWEOIUABLAR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|